Difference between revisions of "GLUTARYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Short-Chain-Trans-23-Dehydroacyl-CoA == * common-name: ** a short-chain trans-2,3-dehydroacyl-coa == Reaction(s) known to consume the com...") |
(Created page with "Category:metabolite == Metabolite GLUTARYL-COA == * common-name: ** glutaryl-coa * molecular-weight: ** 876.595 * inchi-key: ** sykwlijqehrdnh-ckrmaksasa-i * smiles: ** cc...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite GLUTARYL-COA == |
* common-name: | * common-name: | ||
− | ** | + | ** glutaryl-coa |
+ | * molecular-weight: | ||
+ | ** 876.595 | ||
+ | * inchi-key: | ||
+ | ** sykwlijqehrdnh-ckrmaksasa-i | ||
+ | * smiles: | ||
+ | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-8032]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[2-KETO-ADIPATE-DEHYDROG-RXN]] |
+ | * [[RXN-8032]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=glutaryl-coa}} |
+ | {{#set: molecular-weight=876.595}} | ||
+ | {{#set: inchi-key=inchikey=sykwlijqehrdnh-ckrmaksasa-i}} |
Latest revision as of 19:33, 17 March 2021
Contents
Metabolite GLUTARYL-COA
- common-name:
- glutaryl-coa
- molecular-weight:
- 876.595
- inchi-key:
- sykwlijqehrdnh-ckrmaksasa-i
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(cccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]