Difference between revisions of "GLUTARYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Carboxylic-esters == * common-name: ** a carboxylic ester == Reaction(s) known to consume the compound == * CARBOXYLESTERASE-RXN == R...")
 
(Created page with "Category:metabolite == Metabolite GLUTARYL-COA == * common-name: ** glutaryl-coa * molecular-weight: ** 876.595 * inchi-key: ** sykwlijqehrdnh-ckrmaksasa-i * smiles: ** cc...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Carboxylic-esters ==
+
== Metabolite GLUTARYL-COA ==
 
* common-name:
 
* common-name:
** a carboxylic ester
+
** glutaryl-coa
 +
* molecular-weight:
 +
** 876.595
 +
* inchi-key:
 +
** sykwlijqehrdnh-ckrmaksasa-i
 +
* smiles:
 +
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CARBOXYLESTERASE-RXN]]
+
* [[RXN-8032]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2-KETO-ADIPATE-DEHYDROG-RXN]]
 +
* [[RXN-8032]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a carboxylic ester}}
+
{{#set: common-name=glutaryl-coa}}
 +
{{#set: molecular-weight=876.595}}
 +
{{#set: inchi-key=inchikey=sykwlijqehrdnh-ckrmaksasa-i}}

Latest revision as of 19:33, 17 March 2021

Metabolite GLUTARYL-COA

  • common-name:
    • glutaryl-coa
  • molecular-weight:
    • 876.595
  • inchi-key:
    • sykwlijqehrdnh-ckrmaksasa-i
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(cccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality