Difference between revisions of "HYPOXANTHINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17283 == * common-name: ** a [glycerolipid]-di-homo-γ-linolenate == Reaction(s) known to consume the compound == == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite HYPOXANTHINE == * common-name: ** hypoxanthine * molecular-weight: ** 136.113 * inchi-key: ** fdgqstzjbfjubt-uhfffaoysa-n * smiles: ** c1...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite HYPOXANTHINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** hypoxanthine |
| + | * molecular-weight: | ||
| + | ** 136.113 | ||
| + | * inchi-key: | ||
| + | ** fdgqstzjbfjubt-uhfffaoysa-n | ||
| + | * smiles: | ||
| + | ** c1(nc2(=c(n=1)n=cnc(=o)2)) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[INOPHOSPHOR-RXN]] | ||
| + | * [[RXN-7682]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[INOPHOSPHOR-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=hypoxanthine}} |
| + | {{#set: molecular-weight=136.113}} | ||
| + | {{#set: inchi-key=inchikey=fdgqstzjbfjubt-uhfffaoysa-n}} | ||
Latest revision as of 19:33, 17 March 2021
Contents
Metabolite HYPOXANTHINE
- common-name:
- hypoxanthine
- molecular-weight:
- 136.113
- inchi-key:
- fdgqstzjbfjubt-uhfffaoysa-n
- smiles:
- c1(nc2(=c(n=1)n=cnc(=o)2))
