Difference between revisions of "Protein-tyrosine-phosphates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-464 == * common-name: ** prephytoene diphosphate * molecular-weight: ** 719.897 * inchi-key: ** rvcnktpchznaao-imslgmfesa-k * smiles:...")
 
(Created page with "Category:metabolite == Metabolite Protein-tyrosine-phosphates == * common-name: ** a [protein]-l-tyrosine phosphate == Reaction(s) known to consume the compound == * PRO...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-464 ==
+
== Metabolite Protein-tyrosine-phosphates ==
 
* common-name:
 
* common-name:
** prephytoene diphosphate
+
** a [protein]-l-tyrosine phosphate
* molecular-weight:
 
** 719.897
 
* inchi-key:
 
** rvcnktpchznaao-imslgmfesa-k
 
* smiles:
 
** cc(=cccc(=cccc(=cccc(=cc1(c(ccc=c(ccc=c(ccc=c(c)c)c)c)(c1cop(op(=o)([o-])[o-])([o-])=o)c))c)c)c)c
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXNARA-8002]]
+
* [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.5.1.32-RXN]]
+
* [[2.7.10.1-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=prephytoene diphosphate}}
+
{{#set: common-name=a [protein]-l-tyrosine phosphate}}
{{#set: molecular-weight=719.897}}
 
{{#set: inchi-key=inchikey=rvcnktpchznaao-imslgmfesa-k}}
 

Latest revision as of 19:33, 17 March 2021

Metabolite Protein-tyrosine-phosphates

  • common-name:
    • a [protein]-l-tyrosine phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-l-tyrosine phosphate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.