Difference between revisions of "CPD-464"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19171 == * common-name: ** (s)-3-hydroxy-(9z)-octadecenoyl-coa * molecular-weight: ** 1043.952 * inchi-key: ** lhayytcfpmuqnr-dfxypyg...")
 
(Created page with "Category:metabolite == Metabolite CPD-464 == * common-name: ** prephytoene diphosphate * molecular-weight: ** 719.897 * inchi-key: ** rvcnktpchznaao-imslgmfesa-k * smiles:...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19171 ==
+
== Metabolite CPD-464 ==
 
* common-name:
 
* common-name:
** (s)-3-hydroxy-(9z)-octadecenoyl-coa
+
** prephytoene diphosphate
 
* molecular-weight:
 
* molecular-weight:
** 1043.952
+
** 719.897
 
* inchi-key:
 
* inchi-key:
** lhayytcfpmuqnr-dfxypyghsa-j
+
** rvcnktpchznaao-imslgmfesa-k
 
* smiles:
 
* smiles:
** ccccccccc=ccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(=cccc(=cccc(=cccc(=cc1(c(ccc=c(ccc=c(ccc=c(c)c)c)c)(c1cop(op(=o)([o-])[o-])([o-])=o)c))c)c)c)c
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17777]]
+
* [[RXNARA-8002]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17776]]
+
* [[2.5.1.32-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-3-hydroxy-(9z)-octadecenoyl-coa}}
+
{{#set: common-name=prephytoene diphosphate}}
{{#set: molecular-weight=1043.952}}
+
{{#set: molecular-weight=719.897}}
{{#set: inchi-key=inchikey=lhayytcfpmuqnr-dfxypyghsa-j}}
+
{{#set: inchi-key=inchikey=rvcnktpchznaao-imslgmfesa-k}}

Latest revision as of 19:33, 17 March 2021

Metabolite CPD-464

  • common-name:
    • prephytoene diphosphate
  • molecular-weight:
    • 719.897
  • inchi-key:
    • rvcnktpchznaao-imslgmfesa-k
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cc1(c(ccc=c(ccc=c(ccc=c(c)c)c)c)(c1cop(op(=o)([o-])[o-])([o-])=o)c))c)c)c)c

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality