Difference between revisions of "BUTANOL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite LINOLEIC_ACID == * common-name: ** linoleate * molecular-weight: ** 279.442 * inchi-key: ** oyhqolukzrvurq-hzjyttrnsa-m * smiles: ** cccc...")
(Created page with "Category:metabolite == Metabolite BUTANOL == * common-name: ** butan-1-ol * molecular-weight: ** 74.122 * inchi-key: ** lrhpldygymqrhn-uhfffaoysa-n * smiles: ** cccco == R...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite LINOLEIC_ACID ==
+
== Metabolite BUTANOL ==
 
* common-name:
 
* common-name:
** linoleate
+
** butan-1-ol
 
* molecular-weight:
 
* molecular-weight:
** 279.442
+
** 74.122
 
* inchi-key:
 
* inchi-key:
** oyhqolukzrvurq-hzjyttrnsa-m
+
** lrhpldygymqrhn-uhfffaoysa-n
 
* smiles:
 
* smiles:
** cccccc=ccc=ccccccccc([o-])=o
+
** cccco
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[R07063]]
+
* [[ENZRXN-201-RXN]]
* [[RXN-9673]]
+
* [[RXN-161]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[LINOLEOYL-RXN]]
+
* [[ENZRXN-201-RXN]]
 +
* [[RXN-161]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=linoleate}}
+
{{#set: common-name=butan-1-ol}}
{{#set: molecular-weight=279.442}}
+
{{#set: molecular-weight=74.122}}
{{#set: inchi-key=inchikey=oyhqolukzrvurq-hzjyttrnsa-m}}
+
{{#set: inchi-key=inchikey=lrhpldygymqrhn-uhfffaoysa-n}}

Latest revision as of 19:33, 17 March 2021

Metabolite BUTANOL

  • common-name:
    • butan-1-ol
  • molecular-weight:
    • 74.122
  • inchi-key:
    • lrhpldygymqrhn-uhfffaoysa-n
  • smiles:
    • cccco

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality