Difference between revisions of "N-4-aminobutylidene-enzyme-lysine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PORPHOBILINOGEN == * common-name: ** porphobilinogen * molecular-weight: ** 225.224 * inchi-key: ** qshwiqzfgqkfma-uhfffaoysa-m * smiles:...")
(Created page with "Category:metabolite == Metabolite N-4-aminobutylidene-enzyme-lysine == * common-name: ** a [deoxyhypusine synthase]-n-(4-aminobutylidene)-lysine == Reaction(s) known to co...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PORPHOBILINOGEN ==
+
== Metabolite N-4-aminobutylidene-enzyme-lysine ==
 
* common-name:
 
* common-name:
** porphobilinogen
+
** a [deoxyhypusine synthase]-n-(4-aminobutylidene)-lysine
* molecular-weight:
 
** 225.224
 
* inchi-key:
 
** qshwiqzfgqkfma-uhfffaoysa-m
 
* smiles:
 
** c(c1(=c(c(=cn1)ccc(=o)[o-])cc(=o)[o-]))[n+]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[OHMETHYLBILANESYN-RXN]]
+
* [[RXN-13416]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PORPHOBILSYNTH-RXN]]
+
* [[RXN-13415]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=porphobilinogen}}
+
{{#set: common-name=a [deoxyhypusine synthase]-n-(4-aminobutylidene)-lysine}}
{{#set: molecular-weight=225.224}}
 
{{#set: inchi-key=inchikey=qshwiqzfgqkfma-uhfffaoysa-m}}
 

Latest revision as of 19:33, 17 March 2021

Metabolite N-4-aminobutylidene-enzyme-lysine

  • common-name:
    • a [deoxyhypusine synthase]-n-(4-aminobutylidene)-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [deoxyhypusine synthase]-n-(4-aminobutylidene)-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.