Difference between revisions of "DUMP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Cytochromes-C-Oxidized == * common-name: ** an oxidized c-type cytochrome == Reaction(s) known to consume the compound == * 1.10.2.2-RX...") |
(Created page with "Category:metabolite == Metabolite DUMP == * common-name: ** dump * molecular-weight: ** 306.168 * inchi-key: ** jsrljpsbldheio-shyzeuofsa-l * smiles: ** c(op(=o)([o-])[o-]...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DUMP == |
* common-name: | * common-name: | ||
| − | ** | + | ** dump |
| + | * molecular-weight: | ||
| + | ** 306.168 | ||
| + | * inchi-key: | ||
| + | ** jsrljpsbldheio-shyzeuofsa-l | ||
| + | * smiles: | ||
| + | ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2)) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[THYMIDYLATESYN-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[DCMP-DEAMINASE-RXN]] |
| − | * [[ | + | * [[DUTP-PYROP-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dump}} |
| + | {{#set: molecular-weight=306.168}} | ||
| + | {{#set: inchi-key=inchikey=jsrljpsbldheio-shyzeuofsa-l}} | ||
Latest revision as of 19:33, 17 March 2021
Contents
Metabolite DUMP
- common-name:
- dump
- molecular-weight:
- 306.168
- inchi-key:
- jsrljpsbldheio-shyzeuofsa-l
- smiles:
- c(op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2))
