Difference between revisions of "CPD-7671"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite C1 == * common-name: ** udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine * molecul...")
(Created page with "Category:metabolite == Metabolite CPD-7671 == * common-name: ** methanethiol * molecular-weight: ** 48.103 * inchi-key: ** lsdpwzhwypcbbb-uhfffaoysa-n * smiles: ** cs == R...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite C1 ==
+
== Metabolite CPD-7671 ==
 
* common-name:
 
* common-name:
** udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine
+
** methanethiol
 
* molecular-weight:
 
* molecular-weight:
** 1189.924
+
** 48.103
 
* inchi-key:
 
* inchi-key:
** imwoxezvyqdrdf-mczxnmlpsa-j
+
** lsdpwzhwypcbbb-uhfffaoysa-n
 
* smiles:
 
* smiles:
** cc(c(=o)nc(c)c([o-])=o)nc(=o)c(cccc([n+])c(=o)[o-])nc(=o)ccc(c(=o)[o-])nc(=o)c(c)nc(=o)c(c)oc1(c(o)c(co)oc(c(nc(=o)c)1)op([o-])(=o)op([o-])(=o)occ2(c(o)c(o)c(o2)n3(c=cc(=o)nc(=o)3)))
+
** cs
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PHOSNACMURPENTATRANS-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12539]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine}}
+
{{#set: common-name=methanethiol}}
{{#set: molecular-weight=1189.924}}
+
{{#set: molecular-weight=48.103}}
{{#set: inchi-key=inchikey=imwoxezvyqdrdf-mczxnmlpsa-j}}
+
{{#set: inchi-key=inchikey=lsdpwzhwypcbbb-uhfffaoysa-n}}

Latest revision as of 19:33, 17 March 2021

Metabolite CPD-7671

  • common-name:
    • methanethiol
  • molecular-weight:
    • 48.103
  • inchi-key:
    • lsdpwzhwypcbbb-uhfffaoysa-n
  • smiles:
    • cs

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality