Difference between revisions of "TRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite THREO-DS-ISO-CITRATE == * common-name: ** d-threo-isocitrate * molecular-weight: ** 189.101 * inchi-key: ** odblhexudapzau-zafykaaxsa-k *...")
(Created page with "Category:metabolite == Metabolite tRNAs == * common-name: ** an uncharged trna == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite THREO-DS-ISO-CITRATE ==
+
== Metabolite tRNAs ==
 
* common-name:
 
* common-name:
** d-threo-isocitrate
+
** an uncharged trna
* molecular-weight:
 
** 189.101
 
* inchi-key:
 
** odblhexudapzau-zafykaaxsa-k
 
* smiles:
 
** c(=o)(c(cc([o-])=o)c(o)c([o-])=o)[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACONITATEHYDR-RXN]]
 
* [[ISOCIT-CLEAV-RXN]]
 
* [[ISOCITDEH-RXN]]
 
* [[RXN-14047]]
 
* [[RXN-9951]]
 
* [[biomass_rxn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACONITATEHYDR-RXN]]
+
* [[AMINOCYL-TRNA-HYDROLASE-RXN]]
* [[ISOCIT-CLEAV-RXN]]
+
* [[RXN0-6480]]
* [[ISOCITDEH-RXN]]
 
* [[RXN-14047]]
 
* [[RXN-9951]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-threo-isocitrate}}
+
{{#set: common-name=an uncharged trna}}
{{#set: molecular-weight=189.101}}
 
{{#set: inchi-key=inchikey=odblhexudapzau-zafykaaxsa-k}}
 

Latest revision as of 19:33, 17 March 2021

Metabolite tRNAs

  • common-name:
    • an uncharged trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality