Difference between revisions of "Long-Chain-oxoacyl-CoAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-506 == * common-name: ** d-myo-inositol (1,3,4,5)-tetrakisphosphate * molecular-weight: ** 492.013 * inchi-key: ** cipfcgzlfxvxbg-cnw...")
(Created page with "Category:metabolite == Metabolite Long-Chain-oxoacyl-CoAs == * common-name: ** a long-chain 3-oxoacyl-coa == Reaction(s) known to consume the compound == * 1.1.1.211-RXN...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-506 ==
+
== Metabolite Long-Chain-oxoacyl-CoAs ==
 
* common-name:
 
* common-name:
** d-myo-inositol (1,3,4,5)-tetrakisphosphate
+
** a long-chain 3-oxoacyl-coa
* molecular-weight:
 
** 492.013
 
* inchi-key:
 
** cipfcgzlfxvxbg-cnwjwelysa-f
 
* smiles:
 
** c1(o)(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)c(op([o-])([o-])=o)1)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.1.3.62-RXN]]
+
* [[1.1.1.211-RXN]]
* [[RXN-8730]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.1.127-RXN]]
+
* [[1.1.1.211-RXN]]
* [[2.7.1.139-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-myo-inositol (1,3,4,5)-tetrakisphosphate}}
+
{{#set: common-name=a long-chain 3-oxoacyl-coa}}
{{#set: molecular-weight=492.013}}
 
{{#set: inchi-key=inchikey=cipfcgzlfxvxbg-cnwjwelysa-f}}
 

Latest revision as of 19:33, 17 March 2021

Metabolite Long-Chain-oxoacyl-CoAs

  • common-name:
    • a long-chain 3-oxoacyl-coa

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality