Difference between revisions of "5-10-METHENYL-THF-GLU-N"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite RIBOSE-1P == * common-name: ** α-d-ribose-1-phosphate * molecular-weight: ** 228.095 * inchi-key: ** yxjdfqjkerbobm-txicztdvsa-l *...")
(Created page with "Category:metabolite == Metabolite 5-10-METHENYL-THF-GLU-N == * common-name: ** a 5,10-methenyltetrahydrofolate == Reaction(s) known to consume the compound == * METHENYL...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite RIBOSE-1P ==
+
== Metabolite 5-10-METHENYL-THF-GLU-N ==
 
* common-name:
 
* common-name:
** α-d-ribose-1-phosphate
+
** a 5,10-methenyltetrahydrofolate
* molecular-weight:
 
** 228.095
 
* inchi-key:
 
** yxjdfqjkerbobm-txicztdvsa-l
 
* smiles:
 
** c(o)c1(c(o)c(o)c(op(=o)([o-])[o-])o1)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[INOPHOSPHOR-RXN]]
+
* [[METHENYLTHFCYCLOHYDRO-RXN]]
* [[PPENTOMUT-RXN]]
+
* [[METHYLENETHFDEHYDROG-NADP-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[INOPHOSPHOR-RXN]]
+
* [[1.5.1.15-RXN]]
* [[PPENTOMUT-RXN]]
+
* [[5-FORMYL-THF-CYCLO-LIGASE-RXN]]
 +
* [[METHENYLTHFCYCLOHYDRO-RXN]]
 +
* [[METHYLENETHFDEHYDROG-NADP-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-d-ribose-1-phosphate}}
+
{{#set: common-name=a 5,10-methenyltetrahydrofolate}}
{{#set: molecular-weight=228.095}}
 
{{#set: inchi-key=inchikey=yxjdfqjkerbobm-txicztdvsa-l}}
 

Latest revision as of 19:33, 17 March 2021

Metabolite 5-10-METHENYL-THF-GLU-N

  • common-name:
    • a 5,10-methenyltetrahydrofolate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality