Difference between revisions of "Non-Fucosylated-Fucose-Acceptors"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ARACHIDONIC_ACID == * common-name: ** arachidonate * molecular-weight: ** 303.464 * inchi-key: ** yzxbapsdxzzrgb-dofzraljsa-m * smiles: *...")
(Created page with "Category:metabolite == Metabolite Non-Fucosylated-Fucose-Acceptors == * common-name: ** a non fucosylated fucose acceptor == Reaction(s) known to consume the compound == =...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ARACHIDONIC_ACID ==
+
== Metabolite Non-Fucosylated-Fucose-Acceptors ==
 
* common-name:
 
* common-name:
** arachidonate
+
** a non fucosylated fucose acceptor
* molecular-weight:
 
** 303.464
 
* inchi-key:
 
** yzxbapsdxzzrgb-dofzraljsa-m
 
* smiles:
 
** cccccc=ccc=ccc=ccc=ccccc(=o)[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ARACHIDONATE-5-LIPOXYGENASE-RXN]]
 
* [[RXN-13395]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16016]]
+
* [[3.2.1.38-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=arachidonate}}
+
{{#set: common-name=a non fucosylated fucose acceptor}}
{{#set: molecular-weight=303.464}}
 
{{#set: inchi-key=inchikey=yzxbapsdxzzrgb-dofzraljsa-m}}
 

Latest revision as of 19:33, 17 March 2021

Metabolite Non-Fucosylated-Fucose-Acceptors

  • common-name:
    • a non fucosylated fucose acceptor

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality