Difference between revisions of "Non-Fucosylated-Fucose-Acceptors"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite O-UREIDOHOMOSERINE == * common-name: ** o-ureido-l-homoserine * molecular-weight: ** 177.16 * inchi-key: ** sfyvzosiaizwqu-vkhmyheasa-n *...")
(Created page with "Category:metabolite == Metabolite Non-Fucosylated-Fucose-Acceptors == * common-name: ** a non fucosylated fucose acceptor == Reaction(s) known to consume the compound == =...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite O-UREIDOHOMOSERINE ==
+
== Metabolite Non-Fucosylated-Fucose-Acceptors ==
 
* common-name:
 
* common-name:
** o-ureido-l-homoserine
+
** a non fucosylated fucose acceptor
* molecular-weight:
 
** 177.16
 
* inchi-key:
 
** sfyvzosiaizwqu-vkhmyheasa-n
 
* smiles:
 
** c(cc(c(=o)[o-])[n+])onc(n)=o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[3.2.1.38-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=o-ureido-l-homoserine}}
+
{{#set: common-name=a non fucosylated fucose acceptor}}
{{#set: molecular-weight=177.16}}
 
{{#set: inchi-key=inchikey=sfyvzosiaizwqu-vkhmyheasa-n}}
 

Latest revision as of 19:33, 17 March 2021

Metabolite Non-Fucosylated-Fucose-Acceptors

  • common-name:
    • a non fucosylated fucose acceptor

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality