Difference between revisions of "Charged-TRP-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-ASPARTATE == * common-name: ** l-aspartate * molecular-weight: ** 132.096 * inchi-key: ** ckljmwtzizzhcs-reohclbhsa-m * smiles: ** c(c(...")
 
(Created page with "Category:metabolite == Metabolite Charged-TRP-tRNAs == * common-name: ** an l-tryptophanyl-[trnatrp] == Reaction(s) known to consume the compound == == Reaction(s) known t...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-ASPARTATE ==
+
== Metabolite Charged-TRP-tRNAs ==
 
* common-name:
 
* common-name:
** l-aspartate
+
** an l-tryptophanyl-[trnatrp]
* molecular-weight:
 
** 132.096
 
* inchi-key:
 
** ckljmwtzizzhcs-reohclbhsa-m
 
* smiles:
 
** c(c(=o)[o-])c([n+])c(=o)[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
 
* [[ARGSUCCINSYN-RXN]]
 
* [[ASNSYNA-RXN]]
 
* [[ASNSYNB-RXN]]
 
* [[ASPAMINOTRANS-RXN]]
 
* [[ASPARTATE--TRNA-LIGASE-RXN]]
 
* [[ASPARTATEKIN-RXN]]
 
* [[ASPCARBTRANS-RXN]]
 
* [[L-ASPARTATE-OXID-RXN]]
 
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 
* [[RXN-10]]
 
* [[RXN-13697]]
 
* [[SAICARSYN-RXN]]
 
* [[biomass_rxn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.5.1.26-RXN]]
+
* [[TRYPTOPHAN--TRNA-LIGASE-RXN]]
* [[ASPAMINOTRANS-RXN]]
 
* [[ASPARAGHYD-RXN]]
 
* [[ASPCARBTRANS-RXN]]
 
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 
* [[RXN-13697]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-aspartate}}
+
{{#set: common-name=an l-tryptophanyl-[trnatrp]}}
{{#set: molecular-weight=132.096}}
 
{{#set: inchi-key=inchikey=ckljmwtzizzhcs-reohclbhsa-m}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite Charged-TRP-tRNAs

  • common-name:
    • an l-tryptophanyl-[trnatrp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an l-tryptophanyl-[trnatrp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.