Difference between revisions of "CHOLINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite O-UREIDOHOMOSERINE == * common-name: ** o-ureido-l-homoserine * molecular-weight: ** 177.16 * inchi-key: ** sfyvzosiaizwqu-vkhmyheasa-n *...")
(Created page with "Category:metabolite == Metabolite CHOLINE == * common-name: ** choline * molecular-weight: ** 104.172 * inchi-key: ** oeyiohpdsnjkls-uhfffaoysa-n * smiles: ** c(co)[n+](c)...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite O-UREIDOHOMOSERINE ==
+
== Metabolite CHOLINE ==
 
* common-name:
 
* common-name:
** o-ureido-l-homoserine
+
** choline
 
* molecular-weight:
 
* molecular-weight:
** 177.16
+
** 104.172
 
* inchi-key:
 
* inchi-key:
** sfyvzosiaizwqu-vkhmyheasa-n
+
** oeyiohpdsnjkls-uhfffaoysa-n
 
* smiles:
 
* smiles:
** c(cc(c(=o)[o-])[n+])onc(n)=o
+
** c(co)[n+](c)(c)c
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10]]
+
* [[2.7.8.24-RXN]]
 +
* [[RXN0-7230]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17758]]
 +
* [[RXN-5647]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=o-ureido-l-homoserine}}
+
{{#set: common-name=choline}}
{{#set: molecular-weight=177.16}}
+
{{#set: molecular-weight=104.172}}
{{#set: inchi-key=inchikey=sfyvzosiaizwqu-vkhmyheasa-n}}
+
{{#set: inchi-key=inchikey=oeyiohpdsnjkls-uhfffaoysa-n}}

Latest revision as of 19:34, 17 March 2021

Metabolite CHOLINE

  • common-name:
    • choline
  • molecular-weight:
    • 104.172
  • inchi-key:
    • oeyiohpdsnjkls-uhfffaoysa-n
  • smiles:
    • c(co)[n+](c)(c)c

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality