Difference between revisions of "CPD-1789"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-567 == * common-name: ** n6-acetyl-l-lysine * molecular-weight: ** 188.226 * inchi-key: ** dterqygmudwyaz-zetcqymhsa-n * smiles: ** c...")
(Created page with "Category:metabolite == Metabolite CPD-1789 == * common-name: ** dehydro-d-arabinono-1,4-lactone * molecular-weight: ** 146.099 * inchi-key: ** zzzcuofihgpkak-uwtatzphsa-n...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-567 ==
+
== Metabolite CPD-1789 ==
 
* common-name:
 
* common-name:
** n6-acetyl-l-lysine
+
** dehydro-d-arabinono-1,4-lactone
 
* molecular-weight:
 
* molecular-weight:
** 188.226
+
** 146.099
 
* inchi-key:
 
* inchi-key:
** dterqygmudwyaz-zetcqymhsa-n
+
** zzzcuofihgpkak-uwtatzphsa-n
 
* smiles:
 
* smiles:
** cc(nccccc([n+])c(=o)[o-])=o
+
** c(o)c1(c(o)=c(o)c(=o)o1)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[LYSINE-N-ACETYLTRANSFERASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[LYSINE-N-ACETYLTRANSFERASE-RXN]]
+
* [[1.1.3.37-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n6-acetyl-l-lysine}}
+
{{#set: common-name=dehydro-d-arabinono-1,4-lactone}}
{{#set: molecular-weight=188.226}}
+
{{#set: molecular-weight=146.099}}
{{#set: inchi-key=inchikey=dterqygmudwyaz-zetcqymhsa-n}}
+
{{#set: inchi-key=inchikey=zzzcuofihgpkak-uwtatzphsa-n}}

Latest revision as of 19:34, 17 March 2021

Metabolite CPD-1789

  • common-name:
    • dehydro-d-arabinono-1,4-lactone
  • molecular-weight:
    • 146.099
  • inchi-key:
    • zzzcuofihgpkak-uwtatzphsa-n
  • smiles:
    • c(o)c1(c(o)=c(o)c(=o)o1)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality