Difference between revisions of "CPD-14392"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CARBAMATE == * common-name: ** carbamate * molecular-weight: ** 60.032 * inchi-key: ** kxdhjxzqysoelw-uhfffaoysa-m * smiles: ** c(=o)([o-...")
(Created page with "Category:metabolite == Metabolite CPD-14392 == * common-name: ** stearidonoyl-coa * molecular-weight: ** 1021.905 * inchi-key: ** ddhcsalwdprvcn-uswkvxsksa-j * smiles: **...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CARBAMATE ==
+
== Metabolite CPD-14392 ==
 
* common-name:
 
* common-name:
** carbamate
+
** stearidonoyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 60.032
+
** 1021.905
 
* inchi-key:
 
* inchi-key:
** kxdhjxzqysoelw-uhfffaoysa-m
+
** ddhcsalwdprvcn-uswkvxsksa-j
 
* smiles:
 
* smiles:
** c(=o)([o-])n
+
** ccc=ccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14196]]
 
* [[RXN0-5222]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14196]]
+
* [[RXN-16041]]
* [[RXN-16910]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=carbamate}}
+
{{#set: common-name=stearidonoyl-coa}}
{{#set: molecular-weight=60.032}}
+
{{#set: molecular-weight=1021.905}}
{{#set: inchi-key=inchikey=kxdhjxzqysoelw-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=ddhcsalwdprvcn-uswkvxsksa-j}}

Latest revision as of 19:34, 17 March 2021

Metabolite CPD-14392

  • common-name:
    • stearidonoyl-coa
  • molecular-weight:
    • 1021.905
  • inchi-key:
    • ddhcsalwdprvcn-uswkvxsksa-j
  • smiles:
    • ccc=ccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality