Difference between revisions of "CPD-14392"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Spliced-tRNA-precursor == * common_name: ** a spliced trna == Reaction(s) known to consume the compound == == Reaction(s) known to produc...") |
(Created page with "Category:metabolite == Metabolite CPD-14392 == * common-name: ** stearidonoyl-coa * molecular-weight: ** 1021.905 * inchi-key: ** ddhcsalwdprvcn-uswkvxsksa-j * smiles: **...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-14392 == |
| − | * | + | * common-name: |
| − | ** | + | ** stearidonoyl-coa |
| + | * molecular-weight: | ||
| + | ** 1021.905 | ||
| + | * inchi-key: | ||
| + | ** ddhcsalwdprvcn-uswkvxsksa-j | ||
| + | * smiles: | ||
| + | ** ccc=ccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-16041]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: | + | {{#set: common-name=stearidonoyl-coa}} |
| + | {{#set: molecular-weight=1021.905}} | ||
| + | {{#set: inchi-key=inchikey=ddhcsalwdprvcn-uswkvxsksa-j}} | ||
Latest revision as of 19:34, 17 March 2021
Contents
Metabolite CPD-14392
- common-name:
- stearidonoyl-coa
- molecular-weight:
- 1021.905
- inchi-key:
- ddhcsalwdprvcn-uswkvxsksa-j
- smiles:
- ccc=ccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
