Difference between revisions of "GLUTATHIONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Elongation-tRNAMet == * common-name: ** elongator trnamet == Reaction(s) known to consume the compound == * METHIONINE--TRNA-LIGASE-RXN...")
(Created page with "Category:metabolite == Metabolite GLUTATHIONE == * common-name: ** glutathione * molecular-weight: ** 306.313 * inchi-key: ** rwsxrvcmgqzwbv-wdskdsinsa-m * smiles: ** c(s)...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Elongation-tRNAMet ==
+
== Metabolite GLUTATHIONE ==
 
* common-name:
 
* common-name:
** elongator trnamet
+
** glutathione
 +
* molecular-weight:
 +
** 306.313
 +
* inchi-key:
 +
** rwsxrvcmgqzwbv-wdskdsinsa-m
 +
* smiles:
 +
** c(s)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[METHIONINE--TRNA-LIGASE-RXN]]
+
* [[1.11.1.12-RXN]]
 +
* [[1.8.5.1-RXN]]
 +
* [[2.3.2.15-RXN]]
 +
* [[GLUTATHIONE-PEROXIDASE-RXN]]
 +
* [[GLYOXI-RXN]]
 +
* [[GSHTRAN-RXN]]
 +
* [[GST-RXN]]
 +
* [[PRODISULFREDUCT-A-RXN]]
 +
* [[RXN-13673]]
 +
* [[RXN-15680]]
 +
* [[RXN-6601]]
 +
* [[RXN-9157]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[GLUTATHIONE-REDUCT-NADPH-RXN]]
 +
* [[GLUTATHIONE-SYN-RXN]]
 +
* [[GLYOXI-RXN]]
 +
* [[GLYOXII-RXN]]
 +
* [[RXN-13161]]
 +
* [[RXN-15348]]
 +
* [[RXN-16574]]
 +
* [[RXN-2961]]
 +
* [[RXN-7919]]
 +
* [[S-FORMYLGLUTATHIONE-HYDROLASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=elongator trnamet}}
+
{{#set: common-name=glutathione}}
 +
{{#set: molecular-weight=306.313}}
 +
{{#set: inchi-key=inchikey=rwsxrvcmgqzwbv-wdskdsinsa-m}}

Latest revision as of 19:34, 17 March 2021

Metabolite GLUTATHIONE

  • common-name:
    • glutathione
  • molecular-weight:
    • 306.313
  • inchi-key:
    • rwsxrvcmgqzwbv-wdskdsinsa-m
  • smiles:
    • c(s)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality