Difference between revisions of "GLUTATHIONE"

Latest revision as of 19:34, 17 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-1242 ==
+== Metabolite GLUTATHIONE ==
 * common-name:
-** 3-keto-&beta;-d-galactose
+** glutathione
 * molecular-weight:
-** 178.141
+** 306.313
 * inchi-key:
-** apiqnbnbiiccon-fkmsrsahsa-n
+** rwsxrvcmgqzwbv-wdskdsinsa-m
 * smiles:
-** c(o)c1(oc(c(c(c1o)=o)o)o)
+** c(s)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
 == Reaction(s) known to consume the compound ==
+* [[1.11.1.12-RXN]]
+* [[1.8.5.1-RXN]]
+* [[2.3.2.15-RXN]]
+* [[GLUTATHIONE-PEROXIDASE-RXN]]
+* [[GLYOXI-RXN]]
+* [[GSHTRAN-RXN]]
+* [[GST-RXN]]
+* [[PRODISULFREDUCT-A-RXN]]
+* [[RXN-13673]]
+* [[RXN-15680]]
+* [[RXN-6601]]
+* [[RXN-9157]]
 == Reaction(s) known to produce the compound ==
-* [[KETOLACTOSE-RXN]]
+* [[GLUTATHIONE-REDUCT-NADPH-RXN]]
+* [[GLUTATHIONE-SYN-RXN]]
+* [[GLYOXI-RXN]]
+* [[GLYOXII-RXN]]
+* [[RXN-13161]]
+* [[RXN-15348]]
+* [[RXN-16574]]
+* [[RXN-2961]]
+* [[RXN-7919]]
+* [[S-FORMYLGLUTATHIONE-HYDROLASE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=3-keto-&beta;-d-galactose}}
+{{#set: common-name=glutathione}}
-{{#set: molecular-weight=178.141}}
+{{#set: molecular-weight=306.313}}
-{{#set: inchi-key=inchikey=apiqnbnbiiccon-fkmsrsahsa-n}}
+{{#set: inchi-key=inchikey=rwsxrvcmgqzwbv-wdskdsinsa-m}}