Difference between revisions of "Ox-Glutaredoxins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DGMP == * common-name: ** dgmp * molecular-weight: ** 345.208 * inchi-key: ** ltfmzdnnppeqng-kvqbguixsa-l * smiles: ** c(op(=o)([o-])[o-]...")
(Created page with "Category:metabolite == Metabolite Ox-Glutaredoxins == * common-name: ** an oxidized glutaredoxin == Reaction(s) known to consume the compound == * [[PRODISULFREDUCT-A-RXN]...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DGMP ==
+
== Metabolite Ox-Glutaredoxins ==
 
* common-name:
 
* common-name:
** dgmp
+
** an oxidized glutaredoxin
* molecular-weight:
 
** 345.208
 
* inchi-key:
 
** ltfmzdnnppeqng-kvqbguixsa-l
 
* smiles:
 
** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GMKALT-RXN]]
+
* [[PRODISULFREDUCT-A-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-385]]
+
* [[RXN-982]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dgmp}}
+
{{#set: common-name=an oxidized glutaredoxin}}
{{#set: molecular-weight=345.208}}
 
{{#set: inchi-key=inchikey=ltfmzdnnppeqng-kvqbguixsa-l}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite Ox-Glutaredoxins

  • common-name:
    • an oxidized glutaredoxin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality