Difference between revisions of "I-Antigens"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DUTP == * common-name: ** dutp * molecular-weight: ** 464.112 * inchi-key: ** ahcymluzirlxaa-shyzeuofsa-j * smiles: ** c(c2(c(cc(n1(c(nc(...")
 
(Created page with "Category:metabolite == Metabolite i-Antigens == * common-name: ** an i antigen == Reaction(s) known to consume the compound == * RXN-15277 == Reaction(s) known to prod...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DUTP ==
+
== Metabolite i-Antigens ==
 
* common-name:
 
* common-name:
** dutp
+
** an i antigen
* molecular-weight:
 
** 464.112
 
* inchi-key:
 
** ahcymluzirlxaa-shyzeuofsa-j
 
* smiles:
 
** c(c2(c(cc(n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DUTP-PYROP-RXN]]
+
* [[RXN-15277]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DUDPKIN-RXN]]
+
* [[RXN-15276]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dutp}}
+
{{#set: common-name=an i antigen}}
{{#set: molecular-weight=464.112}}
 
{{#set: inchi-key=inchikey=ahcymluzirlxaa-shyzeuofsa-j}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite i-Antigens

  • common-name:
    • an i antigen

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality