Difference between revisions of "CPD-18077"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13524 == * common-name: ** all-trans-retinol * molecular-weight: ** 286.456 * inchi-key: ** fpipgxgpppqfeq-ovsjkpmpsa-n * smiles: **...")
(Created page with "Category:metabolite == Metabolite CPD-18077 == * common-name: ** glc3man9glcnac2-[protein] == Reaction(s) known to consume the compound == * 3.2.1.106-RXN == Reaction(...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13524 ==
+
== Metabolite CPD-18077 ==
 
* common-name:
 
* common-name:
** all-trans-retinol
+
** glc3man9glcnac2-[protein]
* molecular-weight:
 
** 286.456
 
* inchi-key:
 
** fpipgxgpppqfeq-ovsjkpmpsa-n
 
* smiles:
 
** cc(=cc=cc(c)=cco)c=cc1(=c(c)cccc(c)(c)1)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.3.99.23-RXN]]
+
* [[3.2.1.106-RXN]]
* [[RETINOL-DEHYDROGENASE-RXN]]
 
* [[RXN-10841]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.1.1.64-RXN]]
+
* [[2.4.1.119-RXN]]
* [[RETINOL-DEHYDROGENASE-RXN]]
 
* [[RXN-10841]]
 
* [[RXN-12575]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=all-trans-retinol}}
+
{{#set: common-name=glc3man9glcnac2-[protein]}}
{{#set: molecular-weight=286.456}}
 
{{#set: inchi-key=inchikey=fpipgxgpppqfeq-ovsjkpmpsa-n}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite CPD-18077

  • common-name:
    • glc3man9glcnac2-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "glc3man9glcnac2-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.