Difference between revisions of "CPD-194"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13524 == * common-name: ** all-trans-retinol * molecular-weight: ** 286.456 * inchi-key: ** fpipgxgpppqfeq-ovsjkpmpsa-n * smiles: **...") |
(Created page with "Category:metabolite == Metabolite CPD-194 == * common-name: ** 4-nitrophenyl phosphate * molecular-weight: ** 217.074 * inchi-key: ** xzkihkmtemtjqx-uhfffaoysa-l * smiles:...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-194 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-nitrophenyl phosphate |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 217.074 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xzkihkmtemtjqx-uhfffaoysa-l |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(=cc(op([o-])(=o)[o-])=cc=c([n+]([o-])=o)1) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[4-NITROPHENYLPHOSPHATASE-RXN]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-nitrophenyl phosphate}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=217.074}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xzkihkmtemtjqx-uhfffaoysa-l}} |
Latest revision as of 19:34, 17 March 2021
Contents
Metabolite CPD-194
- common-name:
- 4-nitrophenyl phosphate
- molecular-weight:
- 217.074
- inchi-key:
- xzkihkmtemtjqx-uhfffaoysa-l
- smiles:
- c1(=cc(op([o-])(=o)[o-])=cc=c([n+]([o-])=o)1)
