Difference between revisions of "CPD-194"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PROTEIN-C-TERMINAL-S-ETC-CYSTEINE == * common-name: ** a [protein] c-terminal s-farnesyl-l-cysteine == Reaction(s) known to consume the c...") |
(Created page with "Category:metabolite == Metabolite CPD-194 == * common-name: ** 4-nitrophenyl phosphate * molecular-weight: ** 217.074 * inchi-key: ** xzkihkmtemtjqx-uhfffaoysa-l * smiles:...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-194 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-nitrophenyl phosphate |
| + | * molecular-weight: | ||
| + | ** 217.074 | ||
| + | * inchi-key: | ||
| + | ** xzkihkmtemtjqx-uhfffaoysa-l | ||
| + | * smiles: | ||
| + | ** c1(=cc(op([o-])(=o)[o-])=cc=c([n+]([o-])=o)1) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[4-NITROPHENYLPHOSPHATASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-nitrophenyl phosphate}} |
| + | {{#set: molecular-weight=217.074}} | ||
| + | {{#set: inchi-key=inchikey=xzkihkmtemtjqx-uhfffaoysa-l}} | ||
Latest revision as of 19:34, 17 March 2021
Contents
Metabolite CPD-194
- common-name:
- 4-nitrophenyl phosphate
- molecular-weight:
- 217.074
- inchi-key:
- xzkihkmtemtjqx-uhfffaoysa-l
- smiles:
- c1(=cc(op([o-])(=o)[o-])=cc=c([n+]([o-])=o)1)
