Difference between revisions of "NN-DIMETHYLANILINE-N-OXIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite TDP == * common-name: ** dtdp * molecular-weight: ** 399.167 * inchi-key: ** ujlxyodchaelly-xlpzgreqsa-k * smiles: ** cc1(=cn(c(=o)nc(=o)...")
(Created page with "Category:metabolite == Metabolite NN-DIMETHYLANILINE-N-OXIDE == * common-name: ** n,n-dimethylaniline-n-oxide * molecular-weight: ** 137.181 * inchi-key: ** lkqudaoambkkqw...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite TDP ==
+
== Metabolite NN-DIMETHYLANILINE-N-OXIDE ==
 
* common-name:
 
* common-name:
** dtdp
+
** n,n-dimethylaniline-n-oxide
 
* molecular-weight:
 
* molecular-weight:
** 399.167
+
** 137.181
 
* inchi-key:
 
* inchi-key:
** ujlxyodchaelly-xlpzgreqsa-k
+
** lkqudaoambkkqw-uhfffaoysa-n
 
* smiles:
 
* smiles:
** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])[o-])o2))
+
** cn(c)(=o)c1(c=cc=cc=1)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DTDPKIN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DTMPKI-RXN]]
+
* [[1.14.13.8-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dtdp}}
+
{{#set: common-name=n,n-dimethylaniline-n-oxide}}
{{#set: molecular-weight=399.167}}
+
{{#set: molecular-weight=137.181}}
{{#set: inchi-key=inchikey=ujlxyodchaelly-xlpzgreqsa-k}}
+
{{#set: inchi-key=inchikey=lkqudaoambkkqw-uhfffaoysa-n}}

Latest revision as of 19:34, 17 March 2021

Metabolite NN-DIMETHYLANILINE-N-OXIDE

  • common-name:
    • n,n-dimethylaniline-n-oxide
  • molecular-weight:
    • 137.181
  • inchi-key:
    • lkqudaoambkkqw-uhfffaoysa-n
  • smiles:
    • cn(c)(=o)c1(c=cc=cc=1)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality