Difference between revisions of "NN-DIMETHYLANILINE-N-OXIDE"

Latest revision as of 19:34, 17 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite GLUTATHIONE ==
+== Metabolite NN-DIMETHYLANILINE-N-OXIDE ==
 * common-name:
-** glutathione
+** n,n-dimethylaniline-n-oxide
 * molecular-weight:
-** 306.313
+** 137.181
 * inchi-key:
-** rwsxrvcmgqzwbv-wdskdsinsa-m
+** lkqudaoambkkqw-uhfffaoysa-n
 * smiles:
-** c(s)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
+** cn(c)(=o)c1(c=cc=cc=1)
 == Reaction(s) known to consume the compound ==
-* [[1.11.1.12-RXN]]
-* [[1.8.5.1-RXN]]
-* [[2.3.2.15-RXN]]
-* [[GLUTATHIONE-PEROXIDASE-RXN]]
-* [[GLYOXI-RXN]]
-* [[GSHTRAN-RXN]]
-* [[GST-RXN]]
-* [[PRODISULFREDUCT-A-RXN]]
-* [[RXN-13673]]
-* [[RXN-15680]]
-* [[RXN-6601]]
-* [[RXN-9157]]
 == Reaction(s) known to produce the compound ==
-* [[GLUTATHIONE-REDUCT-NADPH-RXN]]
+* [[1.14.13.8-RXN]]
-* [[GLUTATHIONE-SYN-RXN]]
-* [[GLYOXI-RXN]]
-* [[GLYOXII-RXN]]
-* [[RXN-13161]]
-* [[RXN-15348]]
-* [[RXN-16574]]
-* [[RXN-2961]]
-* [[RXN-7919]]
-* [[S-FORMYLGLUTATHIONE-HYDROLASE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=glutathione}}
+{{#set: common-name=n,n-dimethylaniline-n-oxide}}
-{{#set: molecular-weight=306.313}}
+{{#set: molecular-weight=137.181}}
-{{#set: inchi-key=inchikey=rwsxrvcmgqzwbv-wdskdsinsa-m}}
+{{#set: inchi-key=inchikey=lkqudaoambkkqw-uhfffaoysa-n}}