Difference between revisions of "Charged-GLY-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1083 == * common-name: ** (e)-2-methylcrotonoyl-coa * molecular-weight: ** 845.604 * inchi-key: ** pmwatmxoqqznbx-dkbzllmosa-j * smil...")
(Created page with "Category:metabolite == Metabolite Charged-GLY-tRNAs == * common-name: ** a glycyl-[trnagly] == Reaction(s) known to consume the compound == == Reaction(s) known to produce...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-1083 ==
+
== Metabolite Charged-GLY-tRNAs ==
 
* common-name:
 
* common-name:
** (e)-2-methylcrotonoyl-coa
+
** a glycyl-[trnagly]
* molecular-weight:
 
** 845.604
 
* inchi-key:
 
** pmwatmxoqqznbx-dkbzllmosa-j
 
* smiles:
 
** cc=c(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2-METHYLACYL-COA-DEHYDROGENASE-RXN]]
 
* [[RXN-14266]]
 
* [[TIGLYLCOA-HYDROXY-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2-METHYLACYL-COA-DEHYDROGENASE-RXN]]
+
* [[GLYCINE--TRNA-LIGASE-RXN]]
* [[RXN-14266]]
 
* [[TIGLYLCOA-HYDROXY-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(e)-2-methylcrotonoyl-coa}}
+
{{#set: common-name=a glycyl-[trnagly]}}
{{#set: molecular-weight=845.604}}
 
{{#set: inchi-key=inchikey=pmwatmxoqqznbx-dkbzllmosa-j}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite Charged-GLY-tRNAs

  • common-name:
    • a glycyl-[trnagly]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a glycyl-[trnagly" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.