Difference between revisions of "Protein-Lysine-Aminocarbinol"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite IMIDAZOLE-ACETOL-P == * common-name: ** imidazole acetol-phosphate * molecular-weight: ** 218.105 * inchi-key: ** ycffmsolumramd-uhfffaoy...")
(Created page with "Category:metabolite == Metabolite Protein-Lysine-Aminocarbinol == * common-name: ** an n6-(1-hydroxy-2-oxopropyl)-[protein]-l-lysine == Reaction(s) known to consume the co...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite IMIDAZOLE-ACETOL-P ==
+
== Metabolite Protein-Lysine-Aminocarbinol ==
 
* common-name:
 
* common-name:
** imidazole acetol-phosphate
+
** an n6-(1-hydroxy-2-oxopropyl)-[protein]-l-lysine
* molecular-weight:
 
** 218.105
 
* inchi-key:
 
** ycffmsolumramd-uhfffaoysa-l
 
* smiles:
 
** c1(nc=nc=1cc(cop([o-])(=o)[o-])=o)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HISTAMINOTRANS-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HISTAMINOTRANS-RXN]]
+
* [[RXN-17631]]
* [[IMIDPHOSDEHYD-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=imidazole acetol-phosphate}}
+
{{#set: common-name=an n6-(1-hydroxy-2-oxopropyl)-[protein]-l-lysine}}
{{#set: molecular-weight=218.105}}
 
{{#set: inchi-key=inchikey=ycffmsolumramd-uhfffaoysa-l}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite Protein-Lysine-Aminocarbinol

  • common-name:
    • an n6-(1-hydroxy-2-oxopropyl)-[protein]-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an n6-(1-hydroxy-2-oxopropyl)-[protein]-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.