Difference between revisions of "ACETYL-GLU"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15436 == * common-name: ** (5z)-tetradecenoyl-coa * molecular-weight: ** 971.845 * inchi-key: ** mrvdzohjmltlhj-stfckwfxsa-j * smiles...")
(Created page with "Category:metabolite == Metabolite ACETYL-GLU == * common-name: ** n-acetyl-l-glutamate * molecular-weight: ** 187.152 * inchi-key: ** rfmmmvdnipukgg-yfkpbyrvsa-l * smiles:...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15436 ==
+
== Metabolite ACETYL-GLU ==
 
* common-name:
 
* common-name:
** (5z)-tetradecenoyl-coa
+
** n-acetyl-l-glutamate
 
* molecular-weight:
 
* molecular-weight:
** 971.845
+
** 187.152
 
* inchi-key:
 
* inchi-key:
** mrvdzohjmltlhj-stfckwfxsa-j
+
** rfmmmvdnipukgg-yfkpbyrvsa-l
 
* smiles:
 
* smiles:
** ccccccccc=ccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** cc(=o)nc(c([o-])=o)ccc(=o)[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14576]]
+
* [[ACETYLGLUTKIN-RXN]]
 +
* [[N-ACETYLTRANSFER-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17782]]
+
* [[ACETYLGLUTKIN-RXN]]
 +
* [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]]
 +
* [[N-ACETYLTRANSFER-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(5z)-tetradecenoyl-coa}}
+
{{#set: common-name=n-acetyl-l-glutamate}}
{{#set: molecular-weight=971.845}}
+
{{#set: molecular-weight=187.152}}
{{#set: inchi-key=inchikey=mrvdzohjmltlhj-stfckwfxsa-j}}
+
{{#set: inchi-key=inchikey=rfmmmvdnipukgg-yfkpbyrvsa-l}}

Latest revision as of 19:34, 17 March 2021

Metabolite ACETYL-GLU

  • common-name:
    • n-acetyl-l-glutamate
  • molecular-weight:
    • 187.152
  • inchi-key:
    • rfmmmvdnipukgg-yfkpbyrvsa-l
  • smiles:
    • cc(=o)nc(c([o-])=o)ccc(=o)[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality