Difference between revisions of "ACETYL-GLU"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CARDIOLIPIN == * common-name: ** a cardiolipin == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compou...")
 
(Created page with "Category:metabolite == Metabolite ACETYL-GLU == * common-name: ** n-acetyl-l-glutamate * molecular-weight: ** 187.152 * inchi-key: ** rfmmmvdnipukgg-yfkpbyrvsa-l * smiles:...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CARDIOLIPIN ==
+
== Metabolite ACETYL-GLU ==
 
* common-name:
 
* common-name:
** a cardiolipin
+
** n-acetyl-l-glutamate
 +
* molecular-weight:
 +
** 187.152
 +
* inchi-key:
 +
** rfmmmvdnipukgg-yfkpbyrvsa-l
 +
* smiles:
 +
** cc(=o)nc(c([o-])=o)ccc(=o)[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ACETYLGLUTKIN-RXN]]
 +
* [[N-ACETYLTRANSFER-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CARDIOLIPSYN-RXN]]
+
* [[ACETYLGLUTKIN-RXN]]
 +
* [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]]
 +
* [[N-ACETYLTRANSFER-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a cardiolipin}}
+
{{#set: common-name=n-acetyl-l-glutamate}}
 +
{{#set: molecular-weight=187.152}}
 +
{{#set: inchi-key=inchikey=rfmmmvdnipukgg-yfkpbyrvsa-l}}

Latest revision as of 19:34, 17 March 2021

Metabolite ACETYL-GLU

  • common-name:
    • n-acetyl-l-glutamate
  • molecular-weight:
    • 187.152
  • inchi-key:
    • rfmmmvdnipukgg-yfkpbyrvsa-l
  • smiles:
    • cc(=o)nc(c([o-])=o)ccc(=o)[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality