Difference between revisions of "CPD-5441"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Menaquinols == * common-name: ** a menaquinol == Reaction(s) known to consume the compound == * RXN-14107 == Reaction(s) known to pro...") |
(Created page with "Category:metabolite == Metabolite CPD-5441 == * common-name: ** n-dimethylethanolamine phosphate * molecular-weight: ** 168.109 * inchi-key: ** blhvjaaehmlmoi-uhfffaoysa-m...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-5441 == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-dimethylethanolamine phosphate |
| + | * molecular-weight: | ||
| + | ** 168.109 | ||
| + | * inchi-key: | ||
| + | ** blhvjaaehmlmoi-uhfffaoysa-m | ||
| + | * smiles: | ||
| + | ** c[n+](ccop([o-])([o-])=o)c | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-5642]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-dimethylethanolamine phosphate}} |
| + | {{#set: molecular-weight=168.109}} | ||
| + | {{#set: inchi-key=inchikey=blhvjaaehmlmoi-uhfffaoysa-m}} | ||
Latest revision as of 19:34, 17 March 2021
Contents
Metabolite CPD-5441
- common-name:
- n-dimethylethanolamine phosphate
- molecular-weight:
- 168.109
- inchi-key:
- blhvjaaehmlmoi-uhfffaoysa-m
- smiles:
- c[n+](ccop([o-])([o-])=o)c
