Difference between revisions of "HSCN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHOSPHORIBOSYL-ATP == * common-name: ** 1-(5-phospho-β-d-ribosyl)-atp * molecular-weight: ** 714.24 * inchi-key: ** rknhjbvbfhdxgr-k...")
 
(Created page with "Category:metabolite == Metabolite HSCN == * common-name: ** thiocyanate * molecular-weight: ** 58.078 * inchi-key: ** zmzdmbwjuhkjps-uhfffaoysa-m * smiles: ** c(#n)[s-] ==...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHOSPHORIBOSYL-ATP ==
+
== Metabolite HSCN ==
 
* common-name:
 
* common-name:
** 1-(5-phospho-β-d-ribosyl)-atp
+
** thiocyanate
 
* molecular-weight:
 
* molecular-weight:
** 714.24
+
** 58.078
 
* inchi-key:
 
* inchi-key:
** rknhjbvbfhdxgr-keohhstqsa-i
+
** zmzdmbwjuhkjps-uhfffaoysa-m
 
* smiles:
 
* smiles:
** c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop(op(=o)([o-])op(=o)([o-])o)(=o)[o-])o)o))c=n2)n=c3))=n))o4)o)o))op([o-])([o-])=o
+
** c(#n)[s-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
 
* [[HISTPRATPHYD-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
+
* [[RXN0-6359]]
 +
* [[THIOSULFATE-SULFURTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-(5-phospho-β-d-ribosyl)-atp}}
+
{{#set: common-name=thiocyanate}}
{{#set: molecular-weight=714.24}}
+
{{#set: molecular-weight=58.078}}
{{#set: inchi-key=inchikey=rknhjbvbfhdxgr-keohhstqsa-i}}
+
{{#set: inchi-key=inchikey=zmzdmbwjuhkjps-uhfffaoysa-m}}

Latest revision as of 19:34, 17 March 2021

Metabolite HSCN

  • common-name:
    • thiocyanate
  • molecular-weight:
    • 58.078
  • inchi-key:
    • zmzdmbwjuhkjps-uhfffaoysa-m
  • smiles:
    • c(#n)[s-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality