Difference between revisions of "CDPDIACYLGLYCEROL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite EDTA == * common_name: ** edta * smiles: ** c(c[n+](cc([o-])=o)cc([o-])=o)[n+](cc([o-])=o)cc([o-])=o * inchi_key: ** inchikey=kcxvzyzypll...")
(Created page with "Category:metabolite == Metabolite CDPDIACYLGLYCEROL == * common-name: ** a cdp-diacylglycerol == Reaction(s) known to consume the compound == * 2.7.8.11-RXN * 2.7.8....")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite EDTA ==
+
== Metabolite CDPDIACYLGLYCEROL ==
* common_name:
+
* common-name:
** edta
+
** a cdp-diacylglycerol
* smiles:
 
** c(c[n+](cc([o-])=o)cc([o-])=o)[n+](cc([o-])=o)cc([o-])=o
 
* inchi_key:
 
** inchikey=kcxvzyzypllwcc-uhfffaoysa-l
 
* molecular_weight:
 
** 290.229   
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ExchangeSeed-EDTA]]
+
* [[2.7.8.11-RXN]]
* [[TransportSeed-EDTA]]
+
* [[2.7.8.24-RXN]]
 +
* [[PHOSPHAGLYPSYN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ExchangeSeed-EDTA]]
+
* [[CDPDIGLYSYN-RXN]]
* [[TransportSeed-EDTA]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common_name=edta}}
+
{{#set: common-name=a cdp-diacylglycerol}}
{{#set: inchi_key=inchikey=kcxvzyzypllwcc-uhfffaoysa-l}}
 
{{#set: molecular_weight=290.229    }}
 

Latest revision as of 19:34, 17 March 2021

Metabolite CDPDIACYLGLYCEROL

  • common-name:
    • a cdp-diacylglycerol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality