Difference between revisions of "CDPDIACYLGLYCEROL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite EDTA == * common_name: ** edta * smiles: ** c(c[n+](cc([o-])=o)cc([o-])=o)[n+](cc([o-])=o)cc([o-])=o * inchi_key: ** inchikey=kcxvzyzypll...") |
(Created page with "Category:metabolite == Metabolite CDPDIACYLGLYCEROL == * common-name: ** a cdp-diacylglycerol == Reaction(s) known to consume the compound == * 2.7.8.11-RXN * 2.7.8....") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CDPDIACYLGLYCEROL == |
− | * | + | * common-name: |
− | + | ** a cdp-diacylglycerol | |
− | |||
− | |||
− | |||
− | ** | ||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2.7.8.11-RXN]] |
− | * [[ | + | * [[2.7.8.24-RXN]] |
+ | * [[PHOSPHAGLYPSYN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[CDPDIGLYSYN-RXN]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: | + | {{#set: common-name=a cdp-diacylglycerol}} |
− | |||
− |
Latest revision as of 19:34, 17 March 2021
Contents
Metabolite CDPDIACYLGLYCEROL
- common-name:
- a cdp-diacylglycerol