Difference between revisions of "PROT-CYS"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15666 == * common-name: ** 2-trans,6-cis-tridecadienoyl-coa * molecular-weight: ** 955.803 * inchi-key: ** oosdlbaxvxkfib-gtubxknvsa-...")
(Created page with "Category:metabolite == Metabolite PROT-CYS == * common-name: ** a [protein]-l-cysteine == Reaction(s) known to consume the compound == * 2.1.1.63-RXN * [[2.5.1.58-RXN]...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15666 ==
+
== Metabolite PROT-CYS ==
 
* common-name:
 
* common-name:
** 2-trans,6-cis-tridecadienoyl-coa
+
** a [protein]-l-cysteine
* molecular-weight:
 
** 955.803
 
* inchi-key:
 
** oosdlbaxvxkfib-gtubxknvsa-j
 
* smiles:
 
** ccccccc=cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.1.1.63-RXN]]
 +
* [[2.5.1.58-RXN]]
 +
* [[RXN-14554]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14771]]
+
* [[2.5.1.58-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-trans,6-cis-tridecadienoyl-coa}}
+
{{#set: common-name=a [protein]-l-cysteine}}
{{#set: molecular-weight=955.803}}
 
{{#set: inchi-key=inchikey=oosdlbaxvxkfib-gtubxknvsa-j}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite PROT-CYS

  • common-name:
    • a [protein]-l-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-l-cysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.