Difference between revisions of "Ribonucleoside-Diphosphates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-METHYLTHIOPROPYL-GLUCOSINOLATE == * common-name: ** glucoiberverin * molecular-weight: ** 406.46 * inchi-key: ** zczcvjvujgulmo-bzvdqrp...")
(Created page with "Category:metabolite == Metabolite Ribonucleoside-Diphosphates == * common-name: ** a ribonucleoside diphosphate == Reaction(s) known to consume the compound == * RIBONUC...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-METHYLTHIOPROPYL-GLUCOSINOLATE ==
+
== Metabolite Ribonucleoside-Diphosphates ==
 
* common-name:
 
* common-name:
** glucoiberverin
+
** a ribonucleoside diphosphate
* molecular-weight:
 
** 406.46
 
* inchi-key:
 
** zczcvjvujgulmo-bzvdqrpcsa-m
 
* smiles:
 
** cscccc(=nos(=o)(=o)[o-])sc1(oc(co)c(o)c(o)c(o)1)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-2221]]
+
* [[RIBONUCLEOSIDE-DIP-REDUCTI-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=glucoiberverin}}
+
{{#set: common-name=a ribonucleoside diphosphate}}
{{#set: molecular-weight=406.46}}
 
{{#set: inchi-key=inchikey=zczcvjvujgulmo-bzvdqrpcsa-m}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite Ribonucleoside-Diphosphates

  • common-name:
    • a ribonucleoside diphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality