Difference between revisions of "FORMYL-THF-GLU-N"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite XANTHURENATE == * common-name: ** xanthurenate * molecular-weight: ** 203.154 * inchi-key: ** fbzonxhggphhiy-uhfffaoysa-l * smiles: ** c1...")
 
(Created page with "Category:metabolite == Metabolite FORMYL-THF-GLU-N == * common-name: ** a 10-formyltetrahydrofolate == Reaction(s) known to consume the compound == * [[AICARTRANSFORM-RXN]...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite XANTHURENATE ==
+
== Metabolite FORMYL-THF-GLU-N ==
 
* common-name:
 
* common-name:
** xanthurenate
+
** a 10-formyltetrahydrofolate
* molecular-weight:
 
** 203.154
 
* inchi-key:
 
** fbzonxhggphhiy-uhfffaoysa-l
 
* smiles:
 
** c1(=cc2(=c(c(o)=c1)n=c(c=c([o-])2)c(=o)[o-]))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[AICARTRANSFORM-RXN]]
 +
* [[FORMATETHFLIG-RXN]]
 +
* [[FORMYLTHFDEFORMYL-RXN]]
 +
* [[FORMYLTHFGLUSYNTH-RXN]]
 +
* [[GART-RXN]]
 +
* [[METHENYLTHFCYCLOHYDRO-RXN]]
 +
* [[METHIONYL-TRNA-FORMYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10722]]
+
* [[AICARTRANSFORM-RXN]]
 +
* [[FORMATETHFLIG-RXN]]
 +
* [[FORMYLTHFGLUSYNTH-RXN]]
 +
* [[GART-RXN]]
 +
* [[METHENYLTHFCYCLOHYDRO-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=xanthurenate}}
+
{{#set: common-name=a 10-formyltetrahydrofolate}}
{{#set: molecular-weight=203.154}}
 
{{#set: inchi-key=inchikey=fbzonxhggphhiy-uhfffaoysa-l}}
 

Latest revision as of 19:34, 17 March 2021