Difference between revisions of "ADENOSYL-P4"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Alkyl-enyl-acyl-gly-P-EtOH-amines == * common-name: ** a plasmenylethanolamine == Reaction(s) known to consume the compound == * RXN-17...") |
(Created page with "Category:metabolite == Metabolite ADENOSYL-P4 == * common-name: ** p1,p4-bis(5'-adenosyl) tetraphosphate * molecular-weight: ** 832.36 * inchi-key: ** yoahknvsncmzgq-xpwfq...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ADENOSYL-P4 == |
* common-name: | * common-name: | ||
− | ** | + | ** p1,p4-bis(5'-adenosyl) tetraphosphate |
+ | * molecular-weight: | ||
+ | ** 832.36 | ||
+ | * inchi-key: | ||
+ | ** yoahknvsncmzgq-xpwfqurosa-j | ||
+ | * smiles: | ||
+ | ** c(c1(c(c(c(o1)n3(c=nc2(c(=nc=nc=23)n)))o)o))op(op(op(op(occ4(c(c(c(o4)n6(c=nc5(c(=nc=nc=56)n)))o)o))([o-])=o)([o-])=o)([o-])=o)([o-])=o | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[ATP-ADENYLYLTRANSFERASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[ATP-ADENYLYLTRANSFERASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=p1,p4-bis(5'-adenosyl) tetraphosphate}} |
+ | {{#set: molecular-weight=832.36}} | ||
+ | {{#set: inchi-key=inchikey=yoahknvsncmzgq-xpwfqurosa-j}} |
Latest revision as of 19:34, 17 March 2021
Contents
Metabolite ADENOSYL-P4
- common-name:
- p1,p4-bis(5'-adenosyl) tetraphosphate
- molecular-weight:
- 832.36
- inchi-key:
- yoahknvsncmzgq-xpwfqurosa-j
- smiles:
- c(c1(c(c(c(o1)n3(c=nc2(c(=nc=nc=23)n)))o)o))op(op(op(op(occ4(c(c(c(o4)n6(c=nc5(c(=nc=nc=56)n)))o)o))([o-])=o)([o-])=o)([o-])=o)([o-])=o