Difference between revisions of "ADENOSYL-P4"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Alkyl-enyl-acyl-gly-P-EtOH-amines == * common-name: ** a plasmenylethanolamine == Reaction(s) known to consume the compound == * RXN-17...")
(Created page with "Category:metabolite == Metabolite ADENOSYL-P4 == * common-name: ** p1,p4-bis(5'-adenosyl) tetraphosphate * molecular-weight: ** 832.36 * inchi-key: ** yoahknvsncmzgq-xpwfq...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Alkyl-enyl-acyl-gly-P-EtOH-amines ==
+
== Metabolite ADENOSYL-P4 ==
 
* common-name:
 
* common-name:
** a plasmenylethanolamine
+
** p1,p4-bis(5'-adenosyl) tetraphosphate
 +
* molecular-weight:
 +
** 832.36
 +
* inchi-key:
 +
** yoahknvsncmzgq-xpwfqurosa-j
 +
* smiles:
 +
** c(c1(c(c(c(o1)n3(c=nc2(c(=nc=nc=23)n)))o)o))op(op(op(op(occ4(c(c(c(o4)n6(c=nc5(c(=nc=nc=56)n)))o)o))([o-])=o)([o-])=o)([o-])=o)([o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17735]]
+
* [[ATP-ADENYLYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ATP-ADENYLYLTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a plasmenylethanolamine}}
+
{{#set: common-name=p1,p4-bis(5'-adenosyl) tetraphosphate}}
 +
{{#set: molecular-weight=832.36}}
 +
{{#set: inchi-key=inchikey=yoahknvsncmzgq-xpwfqurosa-j}}

Latest revision as of 19:34, 17 March 2021

Metabolite ADENOSYL-P4

  • common-name:
    • p1,p4-bis(5'-adenosyl) tetraphosphate
  • molecular-weight:
    • 832.36
  • inchi-key:
    • yoahknvsncmzgq-xpwfqurosa-j
  • smiles:
    • c(c1(c(c(c(o1)n3(c=nc2(c(=nc=nc=23)n)))o)o))op(op(op(op(occ4(c(c(c(o4)n6(c=nc5(c(=nc=nc=56)n)))o)o))([o-])=o)([o-])=o)([o-])=o)([o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality