Difference between revisions of "CPD-170"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1718 == * common-name: ** 7,8-dihydropterin * molecular-weight: ** 165.154 * inchi-key: ** pxzwkvixskscfr-uhfffaoysa-n * smiles: **...") |
(Created page with "Category:metabolite == Metabolite CPD-170 == * common-name: ** stachyose * molecular-weight: ** 666.583 * inchi-key: ** uqziybxshagnoe-xnsrjbnmsa-n * smiles: ** c(o)c1(c(o...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-170 == |
* common-name: | * common-name: | ||
| − | ** | + | ** stachyose |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 666.583 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** uqziybxshagnoe-xnsrjbnmsa-n |
* smiles: | * smiles: | ||
| − | ** c1( | + | ** c(o)c1(c(o)c(o)c(o)c(o1)occ4(c(o)c(o)c(o)c(occ3(c(o)c(o)c(o)c(oc2(co)(c(o)c(o)c(co)o2))o3))o4)) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[2.4.1.67-RXN]] |
| + | * [[RXN-11501]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[2.4.1.67-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=stachyose}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=666.583}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=uqziybxshagnoe-xnsrjbnmsa-n}} |
Latest revision as of 19:34, 17 March 2021
Contents
Metabolite CPD-170
- common-name:
- stachyose
- molecular-weight:
- 666.583
- inchi-key:
- uqziybxshagnoe-xnsrjbnmsa-n
- smiles:
- c(o)c1(c(o)c(o)c(o)c(o1)occ4(c(o)c(o)c(o)c(occ3(c(o)c(o)c(o)c(oc2(co)(c(o)c(o)c(co)o2))o3))o4))
