Difference between revisions of "MTAC"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-GLUTAMATE-5-P == * common-name: ** γ-l-glutamyl 5-phosphate * molecular-weight: ** 225.094 * inchi-key: ** pjrxvijaernuip-vkhmyhe...")
(Created page with "Category:metabolite == Metabolite MTAC == * common-name: ** a [co(i) methanol-specific corrinoid protein] == Reaction(s) known to consume the compound == * RXN-8096 ==...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-GLUTAMATE-5-P ==
+
== Metabolite MTAC ==
 
* common-name:
 
* common-name:
** γ-l-glutamyl 5-phosphate
+
** a [co(i) methanol-specific corrinoid protein]
* molecular-weight:
 
** 225.094
 
* inchi-key:
 
** pjrxvijaernuip-vkhmyheasa-l
 
* smiles:
 
** c(ccc(c(=o)[o-])[n+])(op([o-])(=o)[o-])=o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLUTSEMIALDEHYDROG-RXN]]
+
* [[RXN-8096]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLUTKIN-RXN]]
+
* [[RXN-8096]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=γ-l-glutamyl 5-phosphate}}
+
{{#set: common-name=a [co(i) methanol-specific corrinoid protein]}}
{{#set: molecular-weight=225.094}}
 
{{#set: inchi-key=inchikey=pjrxvijaernuip-vkhmyheasa-l}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite MTAC

  • common-name:
    • a [co(i) methanol-specific corrinoid protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [co(i) methanol-specific corrinoid protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.