Difference between revisions of "MTAC"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite LYS == * common-name: ** l-lysine * molecular-weight: ** 147.197 * inchi-key: ** kdxkernsbixsrk-yfkpbyrvsa-o * smiles: ** c([n+])cccc([n+...")
(Created page with "Category:metabolite == Metabolite MTAC == * common-name: ** a [co(i) methanol-specific corrinoid protein] == Reaction(s) known to consume the compound == * RXN-8096 ==...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite LYS ==
+
== Metabolite MTAC ==
 
* common-name:
 
* common-name:
** l-lysine
+
** a [co(i) methanol-specific corrinoid protein]
* molecular-weight:
 
** 147.197
 
* inchi-key:
 
** kdxkernsbixsrk-yfkpbyrvsa-o
 
* smiles:
 
** c([n+])cccc([n+])c([o-])=o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[L-LYSINE-OXIDASE-RXN]]
+
* [[RXN-8096]]
* [[LYSINE--TRNA-LIGASE-RXN]]
 
* [[LYSINE-N-ACETYLTRANSFERASE-RXN]]
 
* [[biomass_rxn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DIAMINOPIMDECARB-RXN]]
+
* [[RXN-8096]]
* [[LYSINE-N-ACETYLTRANSFERASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-lysine}}
+
{{#set: common-name=a [co(i) methanol-specific corrinoid protein]}}
{{#set: molecular-weight=147.197}}
 
{{#set: inchi-key=inchikey=kdxkernsbixsrk-yfkpbyrvsa-o}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite MTAC

  • common-name:
    • a [co(i) methanol-specific corrinoid protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [co(i) methanol-specific corrinoid protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.