Difference between revisions of "Cis-5-enoyl-CoA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GAMA-TOCOPHEROL == * common-name: ** γ-tocopherol * molecular-weight: ** 416.686 * inchi-key: ** quedxnhftdjviy-dqczwyhmsa-n * smil...")
(Created page with "Category:metabolite == Metabolite cis-5-enoyl-CoA == * common-name: ** a (5z)-alkan-5-enoyl-coa == Reaction(s) known to consume the compound == * RXN-12518 == Reaction...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite GAMA-TOCOPHEROL ==
+
== Metabolite cis-5-enoyl-CoA ==
 
* common-name:
 
* common-name:
−
** γ-tocopherol
+
** a (5z)-alkan-5-enoyl-coa
−
* molecular-weight:
 
−
** 416.686
 
−
* inchi-key:
 
−
** quedxnhftdjviy-dqczwyhmsa-n
 
−
* smiles:
 
−
** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=c(c)c(=c(o1)2)c))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[TOCOPHEROL-O-METHYLTRANSFERASE-RXN]]
+
* [[RXN-12518]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-2543]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=γ-tocopherol}}
+
{{#set: common-name=a (5z)-alkan-5-enoyl-coa}}
−
{{#set: molecular-weight=416.686}}
 
−
{{#set: inchi-key=inchikey=quedxnhftdjviy-dqczwyhmsa-n}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite cis-5-enoyl-CoA

  • common-name:
    • a (5z)-alkan-5-enoyl-coa

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=Cis-5-enoyl-CoA&oldid=49156"