Difference between revisions of "Cis-5-enoyl-CoA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8890 == * common-name: ** betanidin quinone * molecular-weight: ** 384.301 * inchi-key: ** mcthlmsflmebek-aaeuagobsa-l * smiles: ** c...")
(Created page with "Category:metabolite == Metabolite cis-5-enoyl-CoA == * common-name: ** a (5z)-alkan-5-enoyl-coa == Reaction(s) known to consume the compound == * RXN-12518 == Reaction...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-8890 ==
+
== Metabolite cis-5-enoyl-CoA ==
 
* common-name:
 
* common-name:
−
** betanidin quinone
+
** a (5z)-alkan-5-enoyl-coa
−
* molecular-weight:
 
−
** 384.301
 
−
* inchi-key:
 
−
** mcthlmsflmebek-aaeuagobsa-l
 
−
* smiles:
 
−
** c(=[n+]1(c(c([o-])=o)cc2(c1=cc(=o)c(=o)c=2)))c=c3(c=c(c(=o)[o-])nc(c([o-])=o)c3)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12518]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-8635]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=betanidin quinone}}
+
{{#set: common-name=a (5z)-alkan-5-enoyl-coa}}
−
{{#set: molecular-weight=384.301}}
 
−
{{#set: inchi-key=inchikey=mcthlmsflmebek-aaeuagobsa-l}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite cis-5-enoyl-CoA

  • common-name:
    • a (5z)-alkan-5-enoyl-coa

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=Cis-5-enoyl-CoA&oldid=49156"