Difference between revisions of "CPD-334"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 23S-rRNA-guanine-1835 == * common-name: ** a guanine1835 in 23s rrna == Reaction(s) known to consume the compound == * RXN-11635 == R...") |
(Created page with "Category:metabolite == Metabolite CPD-334 == * common-name: ** 2,3-dioxo-l-gulonate * molecular-weight: ** 191.117 * inchi-key: ** gjqwcdsaoumkse-sthayslisa-m * smiles: **...") |
||
| (2 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-334 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2,3-dioxo-l-gulonate |
| + | * molecular-weight: | ||
| + | ** 191.117 | ||
| + | * inchi-key: | ||
| + | ** gjqwcdsaoumkse-sthayslisa-m | ||
| + | * smiles: | ||
| + | ** c(c(c(c(c(c([o-])=o)=o)=o)o)o)o | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-12870]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-12861]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2,3-dioxo-l-gulonate}} |
| + | {{#set: molecular-weight=191.117}} | ||
| + | {{#set: inchi-key=inchikey=gjqwcdsaoumkse-sthayslisa-m}} | ||
Latest revision as of 19:34, 17 March 2021
Contents
Metabolite CPD-334
- common-name:
- 2,3-dioxo-l-gulonate
- molecular-weight:
- 191.117
- inchi-key:
- gjqwcdsaoumkse-sthayslisa-m
- smiles:
- c(c(c(c(c(c([o-])=o)=o)=o)o)o)o
