Difference between revisions of "ISOVALERYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite MtmC-Proteins == * common-name: ** a [co(i) methylamine-specific corrinoid protein] == Reaction(s) known to consume the compound == * R...")
(Created page with "Category:metabolite == Metabolite ISOVALERYL-COA == * common-name: ** isovaleryl-coa * molecular-weight: ** 847.62 * inchi-key: ** uyvziwwbjmyrcd-zmhdxicwsa-j * smiles: **...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite MtmC-Proteins ==
+
== Metabolite ISOVALERYL-COA ==
 
* common-name:
 
* common-name:
** a [co(i) methylamine-specific corrinoid protein]
+
** isovaleryl-coa
 +
* molecular-weight:
 +
** 847.62
 +
* inchi-key:
 +
** uyvziwwbjmyrcd-zmhdxicwsa-j
 +
* smiles:
 +
** cc(cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8098]]
+
* [[ISOVALERYLCOA-DHLIPOAMIDE-RXN]]
 +
* [[RXN-14264]]
 +
* [[RXN0-2301]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8099]]
+
* [[2KETO-4METHYL-PENTANOATE-DEHYDROG-RXN]]
 +
* [[RXN-14264]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [co(i) methylamine-specific corrinoid protein]}}
+
{{#set: common-name=isovaleryl-coa}}
 +
{{#set: molecular-weight=847.62}}
 +
{{#set: inchi-key=inchikey=uyvziwwbjmyrcd-zmhdxicwsa-j}}

Latest revision as of 19:34, 17 March 2021

Metabolite ISOVALERYL-COA

  • common-name:
    • isovaleryl-coa
  • molecular-weight:
    • 847.62
  • inchi-key:
    • uyvziwwbjmyrcd-zmhdxicwsa-j
  • smiles:
    • cc(cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality