Difference between revisions of "ISOVALERYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-224 == * common-name: ** a dolichyl diphosphate == Reaction(s) known to consume the compound == == Reaction(s) known to produce the c...") |
(Created page with "Category:metabolite == Metabolite ISOVALERYL-COA == * common-name: ** isovaleryl-coa * molecular-weight: ** 847.62 * inchi-key: ** uyvziwwbjmyrcd-zmhdxicwsa-j * smiles: **...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ISOVALERYL-COA == |
* common-name: | * common-name: | ||
− | ** | + | ** isovaleryl-coa |
+ | * molecular-weight: | ||
+ | ** 847.62 | ||
+ | * inchi-key: | ||
+ | ** uyvziwwbjmyrcd-zmhdxicwsa-j | ||
+ | * smiles: | ||
+ | ** cc(cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[ISOVALERYLCOA-DHLIPOAMIDE-RXN]] | ||
+ | * [[RXN-14264]] | ||
+ | * [[RXN0-2301]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[2KETO-4METHYL-PENTANOATE-DEHYDROG-RXN]] |
+ | * [[RXN-14264]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=isovaleryl-coa}} |
+ | {{#set: molecular-weight=847.62}} | ||
+ | {{#set: inchi-key=inchikey=uyvziwwbjmyrcd-zmhdxicwsa-j}} |
Latest revision as of 19:34, 17 March 2021
Contents
Metabolite ISOVALERYL-COA
- common-name:
- isovaleryl-coa
- molecular-weight:
- 847.62
- inchi-key:
- uyvziwwbjmyrcd-zmhdxicwsa-j
- smiles:
- cc(cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c