Difference between revisions of "Protein-L-lysine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite MALTOPENTAOSE == * common-name: ** maltopentaose * molecular-weight: ** 828.725 * inchi-key: ** ftnipwxxignqqf-hzwihctqsa-n * smiles: **...")
(Created page with "Category:metabolite == Metabolite Protein-L-lysine == * common-name: ** a [protein]-l-lysine == Reaction(s) known to consume the compound == * 2.3.2.13-RXN * RXN-176...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite MALTOPENTAOSE ==
+
== Metabolite Protein-L-lysine ==
 
* common-name:
 
* common-name:
** maltopentaose
+
** a [protein]-l-lysine
* molecular-weight:
 
** 828.725
 
* inchi-key:
 
** ftnipwxxignqqf-hzwihctqsa-n
 
* smiles:
 
** c(c5(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co))co))c(c4o)o)co))c(c(c5o)o)o))o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14284]]
+
* [[2.3.2.13-RXN]]
 +
* [[RXN-17631]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14285]]
+
* [[3.4.19.12-RXN]]
 +
* [[RXN-13186]]
 +
* [[RXN-8661]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=maltopentaose}}
+
{{#set: common-name=a [protein]-l-lysine}}
{{#set: molecular-weight=828.725}}
 
{{#set: inchi-key=inchikey=ftnipwxxignqqf-hzwihctqsa-n}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite Protein-L-lysine

  • common-name:
    • a [protein]-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.