Difference between revisions of "CPD1G-1345"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-METHYL-CROTONYL-COA == * common-name: ** 3-methylcrotonyl-coa * molecular-weight: ** 845.604 * inchi-key: ** bxipalatiynhjn-zmhdxicwsa-...")
(Created page with "Category:metabolite == Metabolite CPD1G-1345 == * common-name: ** trehalose-cis-methoxy-mono-mycolate * molecular-weight: ** 1578.544 * inchi-key: ** brqkyadgwzgfar-zvnwtm...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-METHYL-CROTONYL-COA ==
+
== Metabolite CPD1G-1345 ==
 
* common-name:
 
* common-name:
** 3-methylcrotonyl-coa
+
** trehalose-cis-methoxy-mono-mycolate
 
* molecular-weight:
 
* molecular-weight:
** 845.604
+
** 1578.544
 
* inchi-key:
 
* inchi-key:
** bxipalatiynhjn-zmhdxicwsa-j
+
** brqkyadgwzgfar-zvnwtmltsa-n
 
* smiles:
 
* smiles:
** cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
+
** ccccccccccccccccccccccccc(c(occ1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)co)o)o)o)))=o)c(o)cccccccccccccccccc3(c(ccccccccccccccccc(oc)c(c)cccccccccccccccccc)c3)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]]
 
* [[RXN-14264]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11921]]
+
* [[RXN1G-1436]]
* [[RXN-14264]]
 
* [[RXN0-2301]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-methylcrotonyl-coa}}
+
{{#set: common-name=trehalose-cis-methoxy-mono-mycolate}}
{{#set: molecular-weight=845.604}}
+
{{#set: molecular-weight=1578.544}}
{{#set: inchi-key=inchikey=bxipalatiynhjn-zmhdxicwsa-j}}
+
{{#set: inchi-key=inchikey=brqkyadgwzgfar-zvnwtmltsa-n}}

Latest revision as of 19:34, 17 March 2021

Metabolite CPD1G-1345

  • common-name:
    • trehalose-cis-methoxy-mono-mycolate
  • molecular-weight:
    • 1578.544
  • inchi-key:
    • brqkyadgwzgfar-zvnwtmltsa-n
  • smiles:
    • ccccccccccccccccccccccccc(c(occ1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)co)o)o)o)))=o)c(o)cccccccccccccccccc3(c(ccccccccccccccccc(oc)c(c)cccccccccccccccccc)c3)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality