Difference between revisions of "CPD-224"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CANAVANINOSUCCINATE == * common-name: ** canavaninosuccinate * molecular-weight: ** 291.24 * inchi-key: ** sgymgugigtwwlu-rolxfiacsa-m *...")
(Created page with "Category:metabolite == Metabolite CPD-224 == * common-name: ** a dolichyl diphosphate == Reaction(s) known to consume the compound == == Reaction(s) known to produce the c...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CANAVANINOSUCCINATE ==
+
== Metabolite CPD-224 ==
 
* common-name:
 
* common-name:
** canavaninosuccinate
+
** a dolichyl diphosphate
* molecular-weight:
 
** 291.24
 
* inchi-key:
 
** sgymgugigtwwlu-rolxfiacsa-m
 
* smiles:
 
** c(onc(=[n+])nc(cc(=o)[o-])c(=o)[o-])cc([n+])c([o-])=o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-22]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10]]
+
* [[2.4.1.119-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=canavaninosuccinate}}
+
{{#set: common-name=a dolichyl diphosphate}}
{{#set: molecular-weight=291.24}}
 
{{#set: inchi-key=inchikey=sgymgugigtwwlu-rolxfiacsa-m}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite CPD-224

  • common-name:
    • a dolichyl diphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality